C17H13NO2 — CID 11482438
5-methyl-6H-chromeno[4,3-c]isoquinolin-11-one (PubChem CID 11482438) has the molecular formula C17H13NO2 and a molecular weight of 263.30 g/mol. Its IUPAC name is 5-methyl-6H-chromeno[4,3-c]isoquinolin-11-one.
| Compound Name | 5-methyl-6H-chromeno[4,3-c]isoquinolin-11-one |
|---|---|
| PubChem CID | 11482438 |
| Molecular Formula | C17H13NO2 |
| Molecular Weight | 263.30 g/mol |
| Exact Mass | 263.09 |
| IUPAC Name | 5-methyl-6H-chromeno[4,3-c]isoquinolin-11-one |
| SMILES | CN1Cc2ccccc2-c2c1c1ccccc1oc2=O |
| InChI | InChI=1S/C17H13NO2/c1-18-10-11-6-2-3-7-12(11)15-16(18)13-8-4-5-9-14(13)20-17(15)19/h2-9H,10H2,1H3 |
| InChIKey | WFRFPTOXGRDRIS-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 33.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.30 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|