C13H15BrO3 — CID 114824771
(2-bromo-4-methoxyphenyl)-(5-methyloxolan-3-yl)methanone (PubChem CID 114824771) has the molecular formula C13H15BrO3 and a molecular weight of 299.16 g/mol. Its IUPAC name is (2-bromo-4-methoxyphenyl)-(5-methyloxolan-3-yl)methanone.
| Compound Name | (2-bromo-4-methoxyphenyl)-(5-methyloxolan-3-yl)methanone |
|---|---|
| PubChem CID | 114824771 |
| Molecular Formula | C13H15BrO3 |
| Molecular Weight | 299.16 g/mol |
| Exact Mass | 298.02 |
| IUPAC Name | (2-bromo-4-methoxyphenyl)-(5-methyloxolan-3-yl)methanone |
| SMILES | COc1ccc(C(=O)C2COC(C)C2)c(Br)c1 |
| InChI | InChI=1S/C13H15BrO3/c1-8-5-9(7-17-8)13(15)11-4-3-10(16-2)6-12(11)14/h3-4,6,8-9H,5,7H2,1-2H3 |
| InChIKey | RVKHOMAZICUBBO-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.16 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |