C14H17BrO4 — CID 114824821
(2-bromo-4,6-dimethoxyphenyl)-(5-methyloxolan-3-yl)methanone (PubChem CID 114824821) has the molecular formula C14H17BrO4 and a molecular weight of 329.19 g/mol. Its IUPAC name is (2-bromo-4,6-dimethoxyphenyl)-(5-methyloxolan-3-yl)methanone.
| Compound Name | (2-bromo-4,6-dimethoxyphenyl)-(5-methyloxolan-3-yl)methanone |
|---|---|
| PubChem CID | 114824821 |
| Molecular Formula | C14H17BrO4 |
| Molecular Weight | 329.19 g/mol |
| Exact Mass | 328.03 |
| IUPAC Name | (2-bromo-4,6-dimethoxyphenyl)-(5-methyloxolan-3-yl)methanone |
| SMILES | COc1cc(Br)c(C(=O)C2COC(C)C2)c(OC)c1 |
| InChI | InChI=1S/C14H17BrO4/c1-8-4-9(7-19-8)14(16)13-11(15)5-10(17-2)6-12(13)18-3/h5-6,8-9H,4,7H2,1-3H3 |
| InChIKey | VZSYSRMYPWUAFV-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.19 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |