C15H14F3N — CID 114828016
2,5-difluoro-N-[1-(2-fluorophenyl)propan-2-yl]aniline (PubChem CID 114828016) has the molecular formula C15H14F3N and a molecular weight of 265.28 g/mol. Its IUPAC name is 2,5-difluoro-N-[1-(2-fluorophenyl)propan-2-yl]aniline.
| Compound Name | 2,5-difluoro-N-[1-(2-fluorophenyl)propan-2-yl]aniline |
|---|---|
| PubChem CID | 114828016 |
| Molecular Formula | C15H14F3N |
| Molecular Weight | 265.28 g/mol |
| Exact Mass | 265.11 |
| IUPAC Name | 2,5-difluoro-N-[1-(2-fluorophenyl)propan-2-yl]aniline |
| SMILES | CC(Cc1ccccc1F)Nc1cc(F)ccc1F |
| InChI | InChI=1S/C15H14F3N/c1-10(8-11-4-2-3-5-13(11)17)19-15-9-12(16)6-7-14(15)18/h2-7,9-10,19H,8H2,1H3 |
| InChIKey | HRULLKFROBFOJV-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.28 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |