C15H13Cl3FN — CID 114828437
2,4,6-trichloro-N-[1-(2-fluorophenyl)propan-2-yl]aniline (PubChem CID 114828437) has the molecular formula C15H13Cl3FN and a molecular weight of 332.63 g/mol. Its IUPAC name is 2,4,6-trichloro-N-[1-(2-fluorophenyl)propan-2-yl]aniline.
| Compound Name | 2,4,6-trichloro-N-[1-(2-fluorophenyl)propan-2-yl]aniline |
|---|---|
| PubChem CID | 114828437 |
| Molecular Formula | C15H13Cl3FN |
| Molecular Weight | 332.63 g/mol |
| Exact Mass | 331.01 |
| IUPAC Name | 2,4,6-trichloro-N-[1-(2-fluorophenyl)propan-2-yl]aniline |
| SMILES | CC(Cc1ccccc1F)Nc1c(Cl)cc(Cl)cc1Cl |
| InChI | InChI=1S/C15H13Cl3FN/c1-9(6-10-4-2-3-5-14(10)19)20-15-12(17)7-11(16)8-13(15)18/h2-5,7-9,20H,6H2,1H3 |
| InChIKey | OTMKBXGTUFGCRV-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.63 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |