C17H32OSi — CID 11482911
tert-butyl-[2-[(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]ethoxy]-dimethylsilane (PubChem CID 11482911) has the molecular formula C17H32OSi and a molecular weight of 280.53 g/mol. Its IUPAC name is tert-butyl-[2-[(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]ethoxy]-dimethylsilane.
| Compound Name | tert-butyl-[2-[(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]ethoxy]-dimethylsilane |
|---|---|
| PubChem CID | 11482911 |
| Molecular Formula | C17H32OSi |
| Molecular Weight | 280.53 g/mol |
| Exact Mass | 280.22 |
| IUPAC Name | tert-butyl-[2-[(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]ethoxy]-dimethylsilane |
| SMILES | CC1(C)[C@H]2CC=C(CCO[Si](C)(C)C(C)(C)C)[C@@H]1C2 |
| InChI | InChI=1S/C17H32OSi/c1-16(2,3)19(6,7)18-11-10-13-8-9-14-12-15(13)17(14,4)5/h8,14-15H,9-12H2,1-7H3/t14-,15-/m0/s1 |
| InChIKey | HKKVQXMWWIJGCL-GJZGRUSLSA-N |
| XLogP | 5.39 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.53 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|