C15H24N2O4 — CID 114829523
4-[(1-amino-3-ethoxy-2,2-dimethylcyclobutanecarbonyl)amino]cyclopent-2-ene-1-carboxylic acid (PubChem CID 114829523) has the molecular formula C15H24N2O4 and a molecular weight of 296.37 g/mol. Its IUPAC name is 4-[(1-amino-3-ethoxy-2,2-dimethylcyclobutanecarbonyl)amino]cyclopent-2-ene-1-carboxylic acid.
| Compound Name | 4-[(1-amino-3-ethoxy-2,2-dimethylcyclobutanecarbonyl)amino]cyclopent-2-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 114829523 |
| Molecular Formula | C15H24N2O4 |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.17 |
| IUPAC Name | 4-[(1-amino-3-ethoxy-2,2-dimethylcyclobutanecarbonyl)amino]cyclopent-2-ene-1-carboxylic acid |
| SMILES | CCOC1CC(N)(C(=O)NC2C=CC(C(=O)O)C2)C1(C)C |
| InChI | InChI=1S/C15H24N2O4/c1-4-21-11-8-15(16,14(11,2)3)13(20)17-10-6-5-9(7-10)12(18)19/h5-6,9-11H,4,7-8,16H2,1-3H3,(H,17,20)(H,18,19) |
| InChIKey | DQXSLAPYZDGLJG-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|