C15H30N2O2S — CID 114830086
1-amino-3-ethoxy-N-(4-ethylsulfanylbutan-2-yl)-2,2-dimethylcyclobutane-1-carboxamide (PubChem CID 114830086) has the molecular formula C15H30N2O2S and a molecular weight of 302.48 g/mol. Its IUPAC name is 1-amino-3-ethoxy-N-(4-ethylsulfanylbutan-2-yl)-2,2-dimethylcyclobutane-1-carboxamide.
| Compound Name | 1-amino-3-ethoxy-N-(4-ethylsulfanylbutan-2-yl)-2,2-dimethylcyclobutane-1-carboxamide |
|---|---|
| PubChem CID | 114830086 |
| Molecular Formula | C15H30N2O2S |
| Molecular Weight | 302.48 g/mol |
| Exact Mass | 302.20 |
| IUPAC Name | 1-amino-3-ethoxy-N-(4-ethylsulfanylbutan-2-yl)-2,2-dimethylcyclobutane-1-carboxamide |
| SMILES | CCOC1CC(N)(C(=O)NC(C)CCSCC)C1(C)C |
| InChI | InChI=1S/C15H30N2O2S/c1-6-19-12-10-15(16,14(12,4)5)13(18)17-11(3)8-9-20-7-2/h11-12H,6-10,16H2,1-5H3,(H,17,18) |
| InChIKey | MDOBRCIIDNPSMV-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.48 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|