C12H16O6S — CID 11483094
[(2R,3R,4R)-4-hydroxy-2-(hydroxymethyl)oxolan-3-yl] 4-methylbenzenesulfonate (PubChem CID 11483094) has the molecular formula C12H16O6S and a molecular weight of 288.32 g/mol. Its IUPAC name is [(2R,3R,4R)-4-hydroxy-2-(hydroxymethyl)oxolan-3-yl] 4-methylbenzenesulfonate.
| Compound Name | [(2R,3R,4R)-4-hydroxy-2-(hydroxymethyl)oxolan-3-yl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 11483094 |
| Molecular Formula | C12H16O6S |
| Molecular Weight | 288.32 g/mol |
| Exact Mass | 288.07 |
| IUPAC Name | [(2R,3R,4R)-4-hydroxy-2-(hydroxymethyl)oxolan-3-yl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)O[C@@H]2[C@H](O)CO[C@@H]2CO)cc1 |
| InChI | InChI=1S/C12H16O6S/c1-8-2-4-9(5-3-8)19(15,16)18-12-10(14)7-17-11(12)6-13/h2-5,10-14H,6-7H2,1H3/t10-,11-,12-/m1/s1 |
| InChIKey | RERXZBVHAVQSOM-IJLUTSLNSA-N |
| XLogP | -0.18 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.32 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|