C15H21FN2 — CID 114831761
3-(3-fluorophenyl)-2-methyl-2-N-pent-3-ynylpropane-1,2-diamine (PubChem CID 114831761) has the molecular formula C15H21FN2 and a molecular weight of 248.34 g/mol. Its IUPAC name is 3-(3-fluorophenyl)-2-methyl-2-N-pent-3-ynylpropane-1,2-diamine.
| Compound Name | 3-(3-fluorophenyl)-2-methyl-2-N-pent-3-ynylpropane-1,2-diamine |
|---|---|
| PubChem CID | 114831761 |
| Molecular Formula | C15H21FN2 |
| Molecular Weight | 248.34 g/mol |
| Exact Mass | 248.17 |
| IUPAC Name | 3-(3-fluorophenyl)-2-methyl-2-N-pent-3-ynylpropane-1,2-diamine |
| SMILES | CC#CCCNC(C)(CN)Cc1cccc(F)c1 |
| InChI | InChI=1S/C15H21FN2/c1-3-4-5-9-18-15(2,12-17)11-13-7-6-8-14(16)10-13/h6-8,10,18H,5,9,11-12,17H2,1-2H3 |
| InChIKey | OIBNFQGRSUVGQX-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.34 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|