C16H25FN2O — CID 114831765
3-(3-fluorophenyl)-2-methyl-2-N-[2-(2-methylprop-2-enoxy)ethyl]propane-1,2-diamine (PubChem CID 114831765) has the molecular formula C16H25FN2O and a molecular weight of 280.39 g/mol. Its IUPAC name is 3-(3-fluorophenyl)-2-methyl-2-N-[2-(2-methylprop-2-enoxy)ethyl]propane-1,2-diamine.
| Compound Name | 3-(3-fluorophenyl)-2-methyl-2-N-[2-(2-methylprop-2-enoxy)ethyl]propane-1,2-diamine |
|---|---|
| PubChem CID | 114831765 |
| Molecular Formula | C16H25FN2O |
| Molecular Weight | 280.39 g/mol |
| Exact Mass | 280.20 |
| IUPAC Name | 3-(3-fluorophenyl)-2-methyl-2-N-[2-(2-methylprop-2-enoxy)ethyl]propane-1,2-diamine |
| SMILES | C=C(C)COCCNC(C)(CN)Cc1cccc(F)c1 |
| InChI | InChI=1S/C16H25FN2O/c1-13(2)11-20-8-7-19-16(3,12-18)10-14-5-4-6-15(17)9-14/h4-6,9,19H,1,7-8,10-12,18H2,2-3H3 |
| InChIKey | DRRMVLBVTOUDNX-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.39 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|