C16H23FO3 — CID 114834469
methyl 2-[1-(3-fluorophenyl)-2-hydroxypropan-2-yl]hexanoate (PubChem CID 114834469) has the molecular formula C16H23FO3 and a molecular weight of 282.35 g/mol. Its IUPAC name is methyl 2-[1-(3-fluorophenyl)-2-hydroxypropan-2-yl]hexanoate.
| Compound Name | methyl 2-[1-(3-fluorophenyl)-2-hydroxypropan-2-yl]hexanoate |
|---|---|
| PubChem CID | 114834469 |
| Molecular Formula | C16H23FO3 |
| Molecular Weight | 282.35 g/mol |
| Exact Mass | 282.16 |
| IUPAC Name | methyl 2-[1-(3-fluorophenyl)-2-hydroxypropan-2-yl]hexanoate |
| SMILES | CCCCC(C(=O)OC)C(C)(O)Cc1cccc(F)c1 |
| InChI | InChI=1S/C16H23FO3/c1-4-5-9-14(15(18)20-3)16(2,19)11-12-7-6-8-13(17)10-12/h6-8,10,14,19H,4-5,9,11H2,1-3H3 |
| InChIKey | KERGBMPYGCVCBJ-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.35 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |