C15H22FNO2 — CID 114835091
2-[4-(aminomethyl)oxan-4-yl]-1-(3-fluorophenyl)propan-2-ol (PubChem CID 114835091) has the molecular formula C15H22FNO2 and a molecular weight of 267.34 g/mol. Its IUPAC name is 2-[4-(aminomethyl)oxan-4-yl]-1-(3-fluorophenyl)propan-2-ol.
| Compound Name | 2-[4-(aminomethyl)oxan-4-yl]-1-(3-fluorophenyl)propan-2-ol |
|---|---|
| PubChem CID | 114835091 |
| Molecular Formula | C15H22FNO2 |
| Molecular Weight | 267.34 g/mol |
| Exact Mass | 267.16 |
| IUPAC Name | 2-[4-(aminomethyl)oxan-4-yl]-1-(3-fluorophenyl)propan-2-ol |
| SMILES | CC(O)(Cc1cccc(F)c1)C1(CN)CCOCC1 |
| InChI | InChI=1S/C15H22FNO2/c1-14(18,10-12-3-2-4-13(16)9-12)15(11-17)5-7-19-8-6-15/h2-4,9,18H,5-8,10-11,17H2,1H3 |
| InChIKey | XNHIBTHMPBVANT-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.34 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |