About 3-bromo-5-chloro-2-(2,5-dimethylphenyl)sulfanylpyridine
3-bromo-5-chloro-2-(2,5-dimethylphenyl)sulfanylpyridine (PubChem CID 114837931) has the molecular formula C13H11BrClNS
and a molecular weight of 328.66 g/mol. Its IUPAC name is 3-bromo-5-chloro-2-(2,5-dimethylphenyl)sulfanylpyridine.
Molecular Properties
| Compound Name | 3-bromo-5-chloro-2-(2,5-dimethylphenyl)sulfanylpyridine |
| PubChem CID | 114837931 |
| Molecular Formula | C13H11BrClNS |
| Molecular Weight | 328.66 g/mol |
| Exact Mass | 326.95 |
| IUPAC Name | 3-bromo-5-chloro-2-(2,5-dimethylphenyl)sulfanylpyridine |
| SMILES | Cc1ccc(C)c(Sc2ncc(Cl)cc2Br)c1 |
| InChI | InChI=1S/C13H11BrClNS/c1-8-3-4-9(2)12(5-8)17-13-11(14)6-10(15)7-16-13/h3-7H,1-2H3 |
| InChIKey | NGDWWXBUVUMGDH-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 328.66 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-bromo-5-chloro-2-(2,5-dimethylphenyl)sulfanylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-5-chloro-2-(2,5-dimethylphenyl)sulfanylpyridine?
The IUPAC name of 3-bromo-5-chloro-2-(2,5-dimethylphenyl)sulfanylpyridine (CID 114837931) is 3-bromo-5-chloro-2-(2,5-dimethylphenyl)sulfanylpyridine.
What is the SMILES notation for 3-bromo-5-chloro-2-(2,5-dimethylphenyl)sulfanylpyridine?
The canonical SMILES for 3-bromo-5-chloro-2-(2,5-dimethylphenyl)sulfanylpyridine is Cc1ccc(C)c(Sc2ncc(Cl)cc2Br)c1.
What is the InChIKey of 3-bromo-5-chloro-2-(2,5-dimethylphenyl)sulfanylpyridine?
The InChIKey is NGDWWXBUVUMGDH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11BrClNS/c1-8-3-4-9(2)12(5-8)17-13-11(14)6-10(15)7-16-13/h3-7H,1-2H3.
What are the key properties of 3-bromo-5-chloro-2-(2,5-dimethylphenyl)sulfanylpyridine?
3-bromo-5-chloro-2-(2,5-dimethylphenyl)sulfanylpyridine has a molecular weight of 328.66 g/mol, XLogP of 5.27, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-5-chloro-2-(2,5-dimethylphenyl)sulfanylpyridine is sourced from PubChem (CID 114837931), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).