C13H11BrClNS — CID 114837931
3-bromo-5-chloro-2-(2,5-dimethylphenyl)sulfanylpyridine (PubChem CID 114837931) has the molecular formula C13H11BrClNS and a molecular weight of 328.66 g/mol. Its IUPAC name is 3-bromo-5-chloro-2-(2,5-dimethylphenyl)sulfanylpyridine.
| Compound Name | 3-bromo-5-chloro-2-(2,5-dimethylphenyl)sulfanylpyridine |
|---|---|
| PubChem CID | 114837931 |
| Molecular Formula | C13H11BrClNS |
| Molecular Weight | 328.66 g/mol |
| Exact Mass | 326.95 |
| IUPAC Name | 3-bromo-5-chloro-2-(2,5-dimethylphenyl)sulfanylpyridine |
| SMILES | Cc1ccc(C)c(Sc2ncc(Cl)cc2Br)c1 |
| InChI | InChI=1S/C13H11BrClNS/c1-8-3-4-9(2)12(5-8)17-13-11(14)6-10(15)7-16-13/h3-7H,1-2H3 |
| InChIKey | NGDWWXBUVUMGDH-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.66 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |