C13H18ClFN2S — CID 114843418
2-(4-chloro-2-fluorophenyl)-2-(2-methylthiomorpholin-4-yl)ethanamine (PubChem CID 114843418) has the molecular formula C13H18ClFN2S and a molecular weight of 288.82 g/mol. Its IUPAC name is 2-(4-chloro-2-fluorophenyl)-2-(2-methylthiomorpholin-4-yl)ethanamine.
| Compound Name | 2-(4-chloro-2-fluorophenyl)-2-(2-methylthiomorpholin-4-yl)ethanamine |
|---|---|
| PubChem CID | 114843418 |
| Molecular Formula | C13H18ClFN2S |
| Molecular Weight | 288.82 g/mol |
| Exact Mass | 288.09 |
| IUPAC Name | 2-(4-chloro-2-fluorophenyl)-2-(2-methylthiomorpholin-4-yl)ethanamine |
| SMILES | CC1CN(C(CN)c2ccc(Cl)cc2F)CCS1 |
| InChI | InChI=1S/C13H18ClFN2S/c1-9-8-17(4-5-18-9)13(7-16)11-3-2-10(14)6-12(11)15/h2-3,6,9,13H,4-5,7-8,16H2,1H3 |
| InChIKey | NRNOVWWHBOPXMI-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.82 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |