C17H23N3S — CID 105378848
2-(2-methylquinolin-6-yl)-2-(2-methylthiomorpholin-4-yl)ethanamine (PubChem CID 105378848) has the molecular formula C17H23N3S and a molecular weight of 301.46 g/mol. Its IUPAC name is 2-(2-methylquinolin-6-yl)-2-(2-methylthiomorpholin-4-yl)ethanamine.
| Compound Name | 2-(2-methylquinolin-6-yl)-2-(2-methylthiomorpholin-4-yl)ethanamine |
|---|---|
| PubChem CID | 105378848 |
| Molecular Formula | C17H23N3S |
| Molecular Weight | 301.46 g/mol |
| Exact Mass | 301.16 |
| IUPAC Name | 2-(2-methylquinolin-6-yl)-2-(2-methylthiomorpholin-4-yl)ethanamine |
| SMILES | Cc1ccc2cc(C(CN)N3CCSC(C)C3)ccc2n1 |
| InChI | InChI=1S/C17H23N3S/c1-12-3-4-14-9-15(5-6-16(14)19-12)17(10-18)20-7-8-21-13(2)11-20/h3-6,9,13,17H,7-8,10-11,18H2,1-2H3 |
| InChIKey | JXDMWURRCDYCGM-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.46 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |