C16H22ClN3 — CID 120841918
[1-[(2-methylquinolin-6-yl)methyl]pyrrolidin-2-yl]methanamine;hydrochloride (PubChem CID 120841918) has the molecular formula C16H22ClN3 and a molecular weight of 291.83 g/mol. Its IUPAC name is [1-[(2-methylquinolin-6-yl)methyl]pyrrolidin-2-yl]methanamine;hydrochloride.
| Compound Name | [1-[(2-methylquinolin-6-yl)methyl]pyrrolidin-2-yl]methanamine;hydrochloride |
|---|---|
| PubChem CID | 120841918 |
| Molecular Formula | C16H22ClN3 |
| Molecular Weight | 291.83 g/mol |
| Exact Mass | 291.15 |
| IUPAC Name | [1-[(2-methylquinolin-6-yl)methyl]pyrrolidin-2-yl]methanamine;hydrochloride |
| SMILES | Cc1ccc2cc(CN3CCCC3CN)ccc2n1.Cl |
| InChI | InChI=1S/C16H21N3.ClH/c1-12-4-6-14-9-13(5-7-16(14)18-12)11-19-8-2-3-15(19)10-17;/h4-7,9,15H,2-3,8,10-11,17H2,1H3;1H |
| InChIKey | UUPMYQUHFDMBPT-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.83 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |