C19H27NO4 — CID 11484403
1-O-tert-butyl 2-O-ethyl (2S)-2-benzylpyrrolidine-1,2-dicarboxylate (PubChem CID 11484403) has the molecular formula C19H27NO4 and a molecular weight of 333.43 g/mol. Its IUPAC name is 1-O-tert-butyl 2-O-ethyl (2S)-2-benzylpyrrolidine-1,2-dicarboxylate.
| Compound Name | 1-O-tert-butyl 2-O-ethyl (2S)-2-benzylpyrrolidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 11484403 |
| Molecular Formula | C19H27NO4 |
| Molecular Weight | 333.43 g/mol |
| Exact Mass | 333.19 |
| IUPAC Name | 1-O-tert-butyl 2-O-ethyl (2S)-2-benzylpyrrolidine-1,2-dicarboxylate |
| SMILES | CCOC(=O)[C@@]1(Cc2ccccc2)CCCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C19H27NO4/c1-5-23-16(21)19(14-15-10-7-6-8-11-15)12-9-13-20(19)17(22)24-18(2,3)4/h6-8,10-11H,5,9,12-14H2,1-4H3/t19-/m0/s1 |
| InChIKey | IPGQTXLRGBJRMM-IBGZPJMESA-N |
| XLogP | 3.56 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.43 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |