C14H17ClN2O — CID 114844199
3-[5-chloro-2-formyl-N-(2-methylpropyl)anilino]propanenitrile (PubChem CID 114844199) has the molecular formula C14H17ClN2O and a molecular weight of 264.76 g/mol. Its IUPAC name is 3-[5-chloro-2-formyl-N-(2-methylpropyl)anilino]propanenitrile.
| Compound Name | 3-[5-chloro-2-formyl-N-(2-methylpropyl)anilino]propanenitrile |
|---|---|
| PubChem CID | 114844199 |
| Molecular Formula | C14H17ClN2O |
| Molecular Weight | 264.76 g/mol |
| Exact Mass | 264.10 |
| IUPAC Name | 3-[5-chloro-2-formyl-N-(2-methylpropyl)anilino]propanenitrile |
| SMILES | CC(C)CN(CCC#N)c1cc(Cl)ccc1C=O |
| InChI | InChI=1S/C14H17ClN2O/c1-11(2)9-17(7-3-6-16)14-8-13(15)5-4-12(14)10-18/h4-5,8,10-11H,3,7,9H2,1-2H3 |
| InChIKey | QRQCJDUJCSFHQI-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 44.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.76 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|