C12H13ClF3NO — CID 114844194
4-chloro-2-[propyl(2,2,2-trifluoroethyl)amino]benzaldehyde (PubChem CID 114844194) has the molecular formula C12H13ClF3NO and a molecular weight of 279.69 g/mol. Its IUPAC name is 4-chloro-2-[propyl(2,2,2-trifluoroethyl)amino]benzaldehyde.
| Compound Name | 4-chloro-2-[propyl(2,2,2-trifluoroethyl)amino]benzaldehyde |
|---|---|
| PubChem CID | 114844194 |
| Molecular Formula | C12H13ClF3NO |
| Molecular Weight | 279.69 g/mol |
| Exact Mass | 279.06 |
| IUPAC Name | 4-chloro-2-[propyl(2,2,2-trifluoroethyl)amino]benzaldehyde |
| SMILES | CCCN(CC(F)(F)F)c1cc(Cl)ccc1C=O |
| InChI | InChI=1S/C12H13ClF3NO/c1-2-5-17(8-12(14,15)16)11-6-10(13)4-3-9(11)7-18/h3-4,6-7H,2,5,8H2,1H3 |
| InChIKey | PXETYAUEWKJHQC-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.69 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|