About 4-chloro-2-[[methyl(3,3,3-trifluoropropyl)amino]methyl]benzaldehyde;propane
4-chloro-2-[[methyl(3,3,3-trifluoropropyl)amino]methyl]benzaldehyde;propane (PubChem CID 142834693) has the molecular formula C15H21ClF3NO
and a molecular weight of 323.79 g/mol. Its IUPAC name is 4-chloro-2-[[methyl(3,3,3-trifluoropropyl)amino]methyl]benzaldehyde;propane.
Molecular Properties
| Compound Name | 4-chloro-2-[[methyl(3,3,3-trifluoropropyl)amino]methyl]benzaldehyde;propane |
| PubChem CID | 142834693 |
| Molecular Formula | C15H21ClF3NO |
| Molecular Weight | 323.79 g/mol |
| Exact Mass | 323.13 |
| IUPAC Name | 4-chloro-2-[[methyl(3,3,3-trifluoropropyl)amino]methyl]benzaldehyde;propane |
| SMILES | CCC.CN(CCC(F)(F)F)Cc1cc(Cl)ccc1C=O |
| InChI | InChI=1S/C12H13ClF3NO.C3H8/c1-17(5-4-12(14,15)16)7-10-6-11(13)3-2-9(10)8-18;1-3-2/h2-3,6,8H,4-5,7H2,1H3;3H2,1-2H3 |
| InChIKey | RBDCBLWKDHEPFB-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.79 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 4-chloro-2-[[methyl(3,3,3-trifluoropropyl)amino]methyl]benzaldehyde;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-2-[[methyl(3,3,3-trifluoropropyl)amino]methyl]benzaldehyde;propane?
The IUPAC name of 4-chloro-2-[[methyl(3,3,3-trifluoropropyl)amino]methyl]benzaldehyde;propane (CID 142834693) is 4-chloro-2-[[methyl(3,3,3-trifluoropropyl)amino]methyl]benzaldehyde;propane.
What is the SMILES notation for 4-chloro-2-[[methyl(3,3,3-trifluoropropyl)amino]methyl]benzaldehyde;propane?
The canonical SMILES for 4-chloro-2-[[methyl(3,3,3-trifluoropropyl)amino]methyl]benzaldehyde;propane is CCC.CN(CCC(F)(F)F)Cc1cc(Cl)ccc1C=O.
What is the InChIKey of 4-chloro-2-[[methyl(3,3,3-trifluoropropyl)amino]methyl]benzaldehyde;propane?
The InChIKey is RBDCBLWKDHEPFB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13ClF3NO.C3H8/c1-17(5-4-12(14,15)16)7-10-6-11(13)3-2-9(10)8-18;1-3-2/h2-3,6,8H,4-5,7H2,1H3;3H2,1-2H3.
What are the key properties of 4-chloro-2-[[methyl(3,3,3-trifluoropropyl)amino]methyl]benzaldehyde;propane?
4-chloro-2-[[methyl(3,3,3-trifluoropropyl)amino]methyl]benzaldehyde;propane has a molecular weight of 323.79 g/mol, XLogP of 4.95, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-2-[[methyl(3,3,3-trifluoropropyl)amino]methyl]benzaldehyde;propane is sourced from PubChem (CID 142834693), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).