C12H13F4NO — CID 114067083
3-fluoro-2-[propyl(2,2,2-trifluoroethyl)amino]benzaldehyde (PubChem CID 114067083) has the molecular formula C12H13F4NO and a molecular weight of 263.23 g/mol. Its IUPAC name is 3-fluoro-2-[propyl(2,2,2-trifluoroethyl)amino]benzaldehyde.
| Compound Name | 3-fluoro-2-[propyl(2,2,2-trifluoroethyl)amino]benzaldehyde |
|---|---|
| PubChem CID | 114067083 |
| Molecular Formula | C12H13F4NO |
| Molecular Weight | 263.23 g/mol |
| Exact Mass | 263.09 |
| IUPAC Name | 3-fluoro-2-[propyl(2,2,2-trifluoroethyl)amino]benzaldehyde |
| SMILES | CCCN(CC(F)(F)F)c1c(F)cccc1C=O |
| InChI | InChI=1S/C12H13F4NO/c1-2-6-17(8-12(14,15)16)11-9(7-18)4-3-5-10(11)13/h3-5,7H,2,6,8H2,1H3 |
| InChIKey | ZYGAMUHUVSQBTK-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.23 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|