C15H14Cl2FNO2 — CID 114847764
[3-chloro-4-[(4-chloro-2-fluorophenyl)methoxy]-5-methoxyphenyl]methanamine (PubChem CID 114847764) has the molecular formula C15H14Cl2FNO2 and a molecular weight of 330.19 g/mol. Its IUPAC name is [3-chloro-4-[(4-chloro-2-fluorophenyl)methoxy]-5-methoxyphenyl]methanamine.
| Compound Name | [3-chloro-4-[(4-chloro-2-fluorophenyl)methoxy]-5-methoxyphenyl]methanamine |
|---|---|
| PubChem CID | 114847764 |
| Molecular Formula | C15H14Cl2FNO2 |
| Molecular Weight | 330.19 g/mol |
| Exact Mass | 329.04 |
| IUPAC Name | [3-chloro-4-[(4-chloro-2-fluorophenyl)methoxy]-5-methoxyphenyl]methanamine |
| SMILES | COc1cc(CN)cc(Cl)c1OCc1ccc(Cl)cc1F |
| InChI | InChI=1S/C15H14Cl2FNO2/c1-20-14-5-9(7-19)4-12(17)15(14)21-8-10-2-3-11(16)6-13(10)18/h2-6H,7-8,19H2,1H3 |
| InChIKey | FVONKYVJRAUMJC-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.19 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |