C15H24ClN3O — CID 114848529
2-[4-[4-chloro-2-(ethylaminomethyl)phenyl]piperazin-1-yl]ethanol (PubChem CID 114848529) has the molecular formula C15H24ClN3O and a molecular weight of 297.83 g/mol. Its IUPAC name is 2-[4-[4-chloro-2-(ethylaminomethyl)phenyl]piperazin-1-yl]ethanol.
| Compound Name | 2-[4-[4-chloro-2-(ethylaminomethyl)phenyl]piperazin-1-yl]ethanol |
|---|---|
| PubChem CID | 114848529 |
| Molecular Formula | C15H24ClN3O |
| Molecular Weight | 297.83 g/mol |
| Exact Mass | 297.16 |
| IUPAC Name | 2-[4-[4-chloro-2-(ethylaminomethyl)phenyl]piperazin-1-yl]ethanol |
| SMILES | CCNCc1cc(Cl)ccc1N1CCN(CCO)CC1 |
| InChI | InChI=1S/C15H24ClN3O/c1-2-17-12-13-11-14(16)3-4-15(13)19-7-5-18(6-8-19)9-10-20/h3-4,11,17,20H,2,5-10,12H2,1H3 |
| InChIKey | ALQPZJZPZGWOQO-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 38.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.83 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |