C16H25ClN2O2 — CID 114848738
[1-[5-chloro-2-[(2-methoxyethylamino)methyl]phenyl]piperidin-2-yl]methanol (PubChem CID 114848738) has the molecular formula C16H25ClN2O2 and a molecular weight of 312.84 g/mol. Its IUPAC name is [1-[5-chloro-2-[(2-methoxyethylamino)methyl]phenyl]piperidin-2-yl]methanol.
| Compound Name | [1-[5-chloro-2-[(2-methoxyethylamino)methyl]phenyl]piperidin-2-yl]methanol |
|---|---|
| PubChem CID | 114848738 |
| Molecular Formula | C16H25ClN2O2 |
| Molecular Weight | 312.84 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | [1-[5-chloro-2-[(2-methoxyethylamino)methyl]phenyl]piperidin-2-yl]methanol |
| SMILES | COCCNCc1ccc(Cl)cc1N1CCCCC1CO |
| InChI | InChI=1S/C16H25ClN2O2/c1-21-9-7-18-11-13-5-6-14(17)10-16(13)19-8-3-2-4-15(19)12-20/h5-6,10,15,18,20H,2-4,7-9,11-12H2,1H3 |
| InChIKey | XCHLFLSEWDQSCM-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 44.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.84 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|