C15H23ClN2O3 — CID 114852870
[4-[5-chloro-2-[(2-methoxyethylamino)methyl]phenyl]morpholin-2-yl]methanol (PubChem CID 114852870) has the molecular formula C15H23ClN2O3 and a molecular weight of 314.81 g/mol. Its IUPAC name is [4-[5-chloro-2-[(2-methoxyethylamino)methyl]phenyl]morpholin-2-yl]methanol.
| Compound Name | [4-[5-chloro-2-[(2-methoxyethylamino)methyl]phenyl]morpholin-2-yl]methanol |
|---|---|
| PubChem CID | 114852870 |
| Molecular Formula | C15H23ClN2O3 |
| Molecular Weight | 314.81 g/mol |
| Exact Mass | 314.14 |
| IUPAC Name | [4-[5-chloro-2-[(2-methoxyethylamino)methyl]phenyl]morpholin-2-yl]methanol |
| SMILES | COCCNCc1ccc(Cl)cc1N1CCOC(CO)C1 |
| InChI | InChI=1S/C15H23ClN2O3/c1-20-6-4-17-9-12-2-3-13(16)8-15(12)18-5-7-21-14(10-18)11-19/h2-3,8,14,17,19H,4-7,9-11H2,1H3 |
| InChIKey | OXUUAMRMXOYGHQ-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 53.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.81 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|