C16H25BrN2O2 — CID 63070734
N-[[4-bromo-2-(2-methyl-1,4-oxazepan-4-yl)phenyl]methyl]-2-methoxyethanamine (PubChem CID 63070734) has the molecular formula C16H25BrN2O2 and a molecular weight of 357.29 g/mol. Its IUPAC name is N-[[4-bromo-2-(2-methyl-1,4-oxazepan-4-yl)phenyl]methyl]-2-methoxyethanamine.
| Compound Name | N-[[4-bromo-2-(2-methyl-1,4-oxazepan-4-yl)phenyl]methyl]-2-methoxyethanamine |
|---|---|
| PubChem CID | 63070734 |
| Molecular Formula | C16H25BrN2O2 |
| Molecular Weight | 357.29 g/mol |
| Exact Mass | 356.11 |
| IUPAC Name | N-[[4-bromo-2-(2-methyl-1,4-oxazepan-4-yl)phenyl]methyl]-2-methoxyethanamine |
| SMILES | COCCNCc1ccc(Br)cc1N1CCCOC(C)C1 |
| InChI | InChI=1S/C16H25BrN2O2/c1-13-12-19(7-3-8-21-13)16-10-15(17)5-4-14(16)11-18-6-9-20-2/h4-5,10,13,18H,3,6-9,11-12H2,1-2H3 |
| InChIKey | UFYWLGMZVOMVHF-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.29 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|