C16H23ClN2O — CID 114850325
1-[2-(2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl)-5-chlorophenyl]-N-methylmethanamine (PubChem CID 114850325) has the molecular formula C16H23ClN2O and a molecular weight of 294.83 g/mol. Its IUPAC name is 1-[2-(2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl)-5-chlorophenyl]-N-methylmethanamine.
| Compound Name | 1-[2-(2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl)-5-chlorophenyl]-N-methylmethanamine |
|---|---|
| PubChem CID | 114850325 |
| Molecular Formula | C16H23ClN2O |
| Molecular Weight | 294.83 g/mol |
| Exact Mass | 294.15 |
| IUPAC Name | 1-[2-(2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl)-5-chlorophenyl]-N-methylmethanamine |
| SMILES | CNCc1cc(Cl)ccc1N1CCOC2CCCCC21 |
| InChI | InChI=1S/C16H23ClN2O/c1-18-11-12-10-13(17)6-7-14(12)19-8-9-20-16-5-3-2-4-15(16)19/h6-7,10,15-16,18H,2-5,8-9,11H2,1H3 |
| InChIKey | WCXGKFMDUKIEKK-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.83 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |