C17H25ClN2 — CID 114852999
N-[[2-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)-5-chlorophenyl]methyl]ethanamine (PubChem CID 114852999) has the molecular formula C17H25ClN2 and a molecular weight of 292.85 g/mol. Its IUPAC name is N-[[2-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)-5-chlorophenyl]methyl]ethanamine.
| Compound Name | N-[[2-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)-5-chlorophenyl]methyl]ethanamine |
|---|---|
| PubChem CID | 114852999 |
| Molecular Formula | C17H25ClN2 |
| Molecular Weight | 292.85 g/mol |
| Exact Mass | 292.17 |
| IUPAC Name | N-[[2-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)-5-chlorophenyl]methyl]ethanamine |
| SMILES | CCNCc1cc(Cl)ccc1N1CCC2CCCCC21 |
| InChI | InChI=1S/C17H25ClN2/c1-2-19-12-14-11-15(18)7-8-17(14)20-10-9-13-5-3-4-6-16(13)20/h7-8,11,13,16,19H,2-6,9-10,12H2,1H3 |
| InChIKey | YGGWTYHBMGWZPY-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.85 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |