C17H25ClN2 — CID 114862123
1-[2-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)-4-chlorophenyl]propan-2-amine (PubChem CID 114862123) has the molecular formula C17H25ClN2 and a molecular weight of 292.85 g/mol. Its IUPAC name is 1-[2-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)-4-chlorophenyl]propan-2-amine.
| Compound Name | 1-[2-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)-4-chlorophenyl]propan-2-amine |
|---|---|
| PubChem CID | 114862123 |
| Molecular Formula | C17H25ClN2 |
| Molecular Weight | 292.85 g/mol |
| Exact Mass | 292.17 |
| IUPAC Name | 1-[2-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)-4-chlorophenyl]propan-2-amine |
| SMILES | CC(N)Cc1ccc(Cl)cc1N1CCC2CCCCC21 |
| InChI | InChI=1S/C17H25ClN2/c1-12(19)10-14-6-7-15(18)11-17(14)20-9-8-13-4-2-3-5-16(13)20/h6-7,11-13,16H,2-5,8-10,19H2,1H3 |
| InChIKey | ZCMKYLJKCHRQLX-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.85 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |