C17H23ClN2O — CID 114853355
2-[5-chloro-2-[(cyclopropylamino)methyl]phenyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-ol (PubChem CID 114853355) has the molecular formula C17H23ClN2O and a molecular weight of 306.84 g/mol. Its IUPAC name is 2-[5-chloro-2-[(cyclopropylamino)methyl]phenyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-ol.
| Compound Name | 2-[5-chloro-2-[(cyclopropylamino)methyl]phenyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-ol |
|---|---|
| PubChem CID | 114853355 |
| Molecular Formula | C17H23ClN2O |
| Molecular Weight | 306.84 g/mol |
| Exact Mass | 306.15 |
| IUPAC Name | 2-[5-chloro-2-[(cyclopropylamino)methyl]phenyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-ol |
| SMILES | OC1CCC2CN(c3cc(Cl)ccc3CNC3CC3)CC12 |
| InChI | InChI=1S/C17H23ClN2O/c18-13-3-1-11(8-19-14-4-5-14)16(7-13)20-9-12-2-6-17(21)15(12)10-20/h1,3,7,12,14-15,17,19,21H,2,4-6,8-10H2 |
| InChIKey | YFCIVOKNWSKYBR-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.84 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |