C19H35NO — CID 114856536
1-(3,5-dimethyl-1-adamantyl)-N-ethyl-4-methoxybutan-1-amine (PubChem CID 114856536) has the molecular formula C19H35NO and a molecular weight of 293.50 g/mol. Its IUPAC name is 1-(3,5-dimethyl-1-adamantyl)-N-ethyl-4-methoxybutan-1-amine.
| Compound Name | 1-(3,5-dimethyl-1-adamantyl)-N-ethyl-4-methoxybutan-1-amine |
|---|---|
| PubChem CID | 114856536 |
| Molecular Formula | C19H35NO |
| Molecular Weight | 293.50 g/mol |
| Exact Mass | 293.27 |
| IUPAC Name | 1-(3,5-dimethyl-1-adamantyl)-N-ethyl-4-methoxybutan-1-amine |
| SMILES | CCNC(CCCOC)C12CC3CC(C)(CC(C)(C3)C1)C2 |
| InChI | InChI=1S/C19H35NO/c1-5-20-16(7-6-8-21-4)19-11-15-9-17(2,13-19)12-18(3,10-15)14-19/h15-16,20H,5-14H2,1-4H3 |
| InChIKey | JVFPPMSZQMPUBJ-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.50 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|