C13H9ClF2N2O3 — CID 114857292
[5-chloro-2-(2,5-difluoro-4-nitrophenoxy)phenyl]methanamine (PubChem CID 114857292) has the molecular formula C13H9ClF2N2O3 and a molecular weight of 314.68 g/mol. Its IUPAC name is [5-chloro-2-(2,5-difluoro-4-nitrophenoxy)phenyl]methanamine.
| Compound Name | [5-chloro-2-(2,5-difluoro-4-nitrophenoxy)phenyl]methanamine |
|---|---|
| PubChem CID | 114857292 |
| Molecular Formula | C13H9ClF2N2O3 |
| Molecular Weight | 314.68 g/mol |
| Exact Mass | 314.03 |
| IUPAC Name | [5-chloro-2-(2,5-difluoro-4-nitrophenoxy)phenyl]methanamine |
| SMILES | NCc1cc(Cl)ccc1Oc1cc(F)c([N+](=O)[O-])cc1F |
| InChI | InChI=1S/C13H9ClF2N2O3/c14-8-1-2-12(7(3-8)6-17)21-13-5-9(15)11(18(19)20)4-10(13)16/h1-5H,6,17H2 |
| InChIKey | RDALTUACTRLICL-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 78.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.68 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|