C13H8F3NO4 — CID 63598315
[2-(2,5-difluoro-4-nitrophenoxy)-5-fluorophenyl]methanol (PubChem CID 63598315) has the molecular formula C13H8F3NO4 and a molecular weight of 299.20 g/mol. Its IUPAC name is [2-(2,5-difluoro-4-nitrophenoxy)-5-fluorophenyl]methanol.
| Compound Name | [2-(2,5-difluoro-4-nitrophenoxy)-5-fluorophenyl]methanol |
|---|---|
| PubChem CID | 63598315 |
| Molecular Formula | C13H8F3NO4 |
| Molecular Weight | 299.20 g/mol |
| Exact Mass | 299.04 |
| IUPAC Name | [2-(2,5-difluoro-4-nitrophenoxy)-5-fluorophenyl]methanol |
| SMILES | O=[N+]([O-])c1cc(F)c(Oc2ccc(F)cc2CO)cc1F |
| InChI | InChI=1S/C13H8F3NO4/c14-8-1-2-12(7(3-8)6-18)21-13-5-9(15)11(17(19)20)4-10(13)16/h1-5,18H,6H2 |
| InChIKey | LSOCJGRUWLVSFG-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 72.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.20 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|