C14H16ClNO2S — CID 114858237
(E)-3-[5-chloro-2-(1,4-thiazepan-4-yl)phenyl]prop-2-enoic acid (PubChem CID 114858237) has the molecular formula C14H16ClNO2S and a molecular weight of 297.81 g/mol. Its IUPAC name is (E)-3-[5-chloro-2-(1,4-thiazepan-4-yl)phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[5-chloro-2-(1,4-thiazepan-4-yl)phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 114858237 |
| Molecular Formula | C14H16ClNO2S |
| Molecular Weight | 297.81 g/mol |
| Exact Mass | 297.06 |
| IUPAC Name | (E)-3-[5-chloro-2-(1,4-thiazepan-4-yl)phenyl]prop-2-enoic acid |
| SMILES | O=C(O)/C=C/c1cc(Cl)ccc1N1CCCSCC1 |
| InChI | InChI=1S/C14H16ClNO2S/c15-12-3-4-13(11(10-12)2-5-14(17)18)16-6-1-8-19-9-7-16/h2-5,10H,1,6-9H2,(H,17,18)/b5-2+ |
| InChIKey | UGOHRGKEIWPOGO-GORDUTHDSA-N |
| XLogP | 3.38 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.81 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|