C16H20ClNO3 — CID 114858335
(E)-3-[4-chloro-2-(3-ethoxypiperidin-1-yl)phenyl]prop-2-enoic acid (PubChem CID 114858335) has the molecular formula C16H20ClNO3 and a molecular weight of 309.79 g/mol. Its IUPAC name is (E)-3-[4-chloro-2-(3-ethoxypiperidin-1-yl)phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-chloro-2-(3-ethoxypiperidin-1-yl)phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 114858335 |
| Molecular Formula | C16H20ClNO3 |
| Molecular Weight | 309.79 g/mol |
| Exact Mass | 309.11 |
| IUPAC Name | (E)-3-[4-chloro-2-(3-ethoxypiperidin-1-yl)phenyl]prop-2-enoic acid |
| SMILES | CCOC1CCCN(c2cc(Cl)ccc2/C=C/C(=O)O)C1 |
| InChI | InChI=1S/C16H20ClNO3/c1-2-21-14-4-3-9-18(11-14)15-10-13(17)7-5-12(15)6-8-16(19)20/h5-8,10,14H,2-4,9,11H2,1H3,(H,19,20)/b8-6+ |
| InChIKey | RPOBKUWDPGVXJW-SOFGYWHQSA-N |
| XLogP | 3.44 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.79 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|