C14H18ClNO2 — CID 42656405
(3-chlorophenyl)-(3-ethoxypiperidin-1-yl)methanone (PubChem CID 42656405) has the molecular formula C14H18ClNO2 and a molecular weight of 267.76 g/mol. Its IUPAC name is (3-chlorophenyl)-(3-ethoxypiperidin-1-yl)methanone.
| Compound Name | (3-chlorophenyl)-(3-ethoxypiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 42656405 |
| Molecular Formula | C14H18ClNO2 |
| Molecular Weight | 267.76 g/mol |
| Exact Mass | 267.10 |
| IUPAC Name | (3-chlorophenyl)-(3-ethoxypiperidin-1-yl)methanone |
| SMILES | CCOC1CCCN(C(=O)c2cccc(Cl)c2)C1 |
| InChI | InChI=1S/C14H18ClNO2/c1-2-18-13-7-4-8-16(10-13)14(17)11-5-3-6-12(15)9-11/h3,5-6,9,13H,2,4,7-8,10H2,1H3 |
| InChIKey | KJYJXRPOPOSGNX-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.76 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |