C17H23ClN2S — CID 114861946
2-(2-aminopropyl)-4-chloro-N-methyl-N-(1-thiophen-2-ylpropan-2-yl)aniline (PubChem CID 114861946) has the molecular formula C17H23ClN2S and a molecular weight of 322.91 g/mol. Its IUPAC name is 2-(2-aminopropyl)-4-chloro-N-methyl-N-(1-thiophen-2-ylpropan-2-yl)aniline.
| Compound Name | 2-(2-aminopropyl)-4-chloro-N-methyl-N-(1-thiophen-2-ylpropan-2-yl)aniline |
|---|---|
| PubChem CID | 114861946 |
| Molecular Formula | C17H23ClN2S |
| Molecular Weight | 322.91 g/mol |
| Exact Mass | 322.13 |
| IUPAC Name | 2-(2-aminopropyl)-4-chloro-N-methyl-N-(1-thiophen-2-ylpropan-2-yl)aniline |
| SMILES | CC(N)Cc1cc(Cl)ccc1N(C)C(C)Cc1cccs1 |
| InChI | InChI=1S/C17H23ClN2S/c1-12(19)9-14-11-15(18)6-7-17(14)20(3)13(2)10-16-5-4-8-21-16/h4-8,11-13H,9-10,19H2,1-3H3 |
| InChIKey | KQMDZZWETCBPAU-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.91 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |