About 1-[5-chloro-2-(4-ethyl-3,5-dimethylpyrazol-1-yl)phenyl]butan-2-amine
1-[5-chloro-2-(4-ethyl-3,5-dimethylpyrazol-1-yl)phenyl]butan-2-amine (PubChem CID 114862477) has the molecular formula C17H24ClN3
and a molecular weight of 305.85 g/mol. Its IUPAC name is 1-[5-chloro-2-(4-ethyl-3,5-dimethylpyrazol-1-yl)phenyl]butan-2-amine.
Molecular Properties
| Compound Name | 1-[5-chloro-2-(4-ethyl-3,5-dimethylpyrazol-1-yl)phenyl]butan-2-amine |
| PubChem CID | 114862477 |
| Molecular Formula | C17H24ClN3 |
| Molecular Weight | 305.85 g/mol |
| Exact Mass | 305.17 |
| IUPAC Name | 1-[5-chloro-2-(4-ethyl-3,5-dimethylpyrazol-1-yl)phenyl]butan-2-amine |
| SMILES | CCc1c(C)nn(-c2ccc(Cl)cc2CC(N)CC)c1C |
| InChI | InChI=1S/C17H24ClN3/c1-5-15(19)10-13-9-14(18)7-8-17(13)21-12(4)16(6-2)11(3)20-21/h7-9,15H,5-6,10,19H2,1-4H3 |
| InChIKey | OSZQKWMQPJGGSW-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.85 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[5-chloro-2-(4-ethyl-3,5-dimethylpyrazol-1-yl)phenyl]butan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[5-chloro-2-(4-ethyl-3,5-dimethylpyrazol-1-yl)phenyl]butan-2-amine?
The IUPAC name of 1-[5-chloro-2-(4-ethyl-3,5-dimethylpyrazol-1-yl)phenyl]butan-2-amine (CID 114862477) is 1-[5-chloro-2-(4-ethyl-3,5-dimethylpyrazol-1-yl)phenyl]butan-2-amine.
What is the SMILES notation for 1-[5-chloro-2-(4-ethyl-3,5-dimethylpyrazol-1-yl)phenyl]butan-2-amine?
The canonical SMILES for 1-[5-chloro-2-(4-ethyl-3,5-dimethylpyrazol-1-yl)phenyl]butan-2-amine is CCc1c(C)nn(-c2ccc(Cl)cc2CC(N)CC)c1C.
What is the InChIKey of 1-[5-chloro-2-(4-ethyl-3,5-dimethylpyrazol-1-yl)phenyl]butan-2-amine?
The InChIKey is OSZQKWMQPJGGSW-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H24ClN3/c1-5-15(19)10-13-9-14(18)7-8-17(13)21-12(4)16(6-2)11(3)20-21/h7-9,15H,5-6,10,19H2,1-4H3.
What are the key properties of 1-[5-chloro-2-(4-ethyl-3,5-dimethylpyrazol-1-yl)phenyl]butan-2-amine?
1-[5-chloro-2-(4-ethyl-3,5-dimethylpyrazol-1-yl)phenyl]butan-2-amine has a molecular weight of 305.85 g/mol, XLogP of 3.98, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[5-chloro-2-(4-ethyl-3,5-dimethylpyrazol-1-yl)phenyl]butan-2-amine is sourced from PubChem (CID 114862477), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).