C14H17ClN4O — CID 114862569
1-[2-(2-aminobutyl)-4-chlorophenyl]pyrazole-4-carboxamide (PubChem CID 114862569) has the molecular formula C14H17ClN4O and a molecular weight of 292.77 g/mol. Its IUPAC name is 1-[2-(2-aminobutyl)-4-chlorophenyl]pyrazole-4-carboxamide.
| Compound Name | 1-[2-(2-aminobutyl)-4-chlorophenyl]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 114862569 |
| Molecular Formula | C14H17ClN4O |
| Molecular Weight | 292.77 g/mol |
| Exact Mass | 292.11 |
| IUPAC Name | 1-[2-(2-aminobutyl)-4-chlorophenyl]pyrazole-4-carboxamide |
| SMILES | CCC(N)Cc1cc(Cl)ccc1-n1cc(C(N)=O)cn1 |
| InChI | InChI=1S/C14H17ClN4O/c1-2-12(16)6-9-5-11(15)3-4-13(9)19-8-10(7-18-19)14(17)20/h3-5,7-8,12H,2,6,16H2,1H3,(H2,17,20) |
| InChIKey | DJOMMPVAUGOWMP-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 86.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.77 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |