C15H19FN4O — CID 64781223
1-[4-fluoro-2-[(2-methylpropylamino)methyl]phenyl]pyrazole-4-carboxamide (PubChem CID 64781223) has the molecular formula C15H19FN4O and a molecular weight of 290.34 g/mol. Its IUPAC name is 1-[4-fluoro-2-[(2-methylpropylamino)methyl]phenyl]pyrazole-4-carboxamide.
| Compound Name | 1-[4-fluoro-2-[(2-methylpropylamino)methyl]phenyl]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 64781223 |
| Molecular Formula | C15H19FN4O |
| Molecular Weight | 290.34 g/mol |
| Exact Mass | 290.15 |
| IUPAC Name | 1-[4-fluoro-2-[(2-methylpropylamino)methyl]phenyl]pyrazole-4-carboxamide |
| SMILES | CC(C)CNCc1cc(F)ccc1-n1cc(C(N)=O)cn1 |
| InChI | InChI=1S/C15H19FN4O/c1-10(2)6-18-7-11-5-13(16)3-4-14(11)20-9-12(8-19-20)15(17)21/h3-5,8-10,18H,6-7H2,1-2H3,(H2,17,21) |
| InChIKey | FNOCKWQLAWPMST-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.34 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |