C12H15ClFNO2 — CID 114863460
1-(4-chloro-2-fluorophenyl)-3-(2-methoxyethylamino)propan-2-one (PubChem CID 114863460) has the molecular formula C12H15ClFNO2 and a molecular weight of 259.71 g/mol. Its IUPAC name is 1-(4-chloro-2-fluorophenyl)-3-(2-methoxyethylamino)propan-2-one.
| Compound Name | 1-(4-chloro-2-fluorophenyl)-3-(2-methoxyethylamino)propan-2-one |
|---|---|
| PubChem CID | 114863460 |
| Molecular Formula | C12H15ClFNO2 |
| Molecular Weight | 259.71 g/mol |
| Exact Mass | 259.08 |
| IUPAC Name | 1-(4-chloro-2-fluorophenyl)-3-(2-methoxyethylamino)propan-2-one |
| SMILES | COCCNCC(=O)Cc1ccc(Cl)cc1F |
| InChI | InChI=1S/C12H15ClFNO2/c1-17-5-4-15-8-11(16)6-9-2-3-10(13)7-12(9)14/h2-3,7,15H,4-6,8H2,1H3 |
| InChIKey | NIONFKZMRAQLCS-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.71 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|