C17H25N3O — CID 114865283
2,6-dimethyl-4-(3-phenyltriazol-4-yl)heptan-4-ol (PubChem CID 114865283) has the molecular formula C17H25N3O and a molecular weight of 287.41 g/mol. Its IUPAC name is 2,6-dimethyl-4-(3-phenyltriazol-4-yl)heptan-4-ol.
| Compound Name | 2,6-dimethyl-4-(3-phenyltriazol-4-yl)heptan-4-ol |
|---|---|
| PubChem CID | 114865283 |
| Molecular Formula | C17H25N3O |
| Molecular Weight | 287.41 g/mol |
| Exact Mass | 287.20 |
| IUPAC Name | 2,6-dimethyl-4-(3-phenyltriazol-4-yl)heptan-4-ol |
| SMILES | CC(C)CC(O)(CC(C)C)c1cnnn1-c1ccccc1 |
| InChI | InChI=1S/C17H25N3O/c1-13(2)10-17(21,11-14(3)4)16-12-18-19-20(16)15-8-6-5-7-9-15/h5-9,12-14,21H,10-11H2,1-4H3 |
| InChIKey | DVSLORBBGVVGAN-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.41 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |