C11H14ClFN2 — CID 114866692
2-(5-chloro-2-fluorophenyl)-1-methylpyrrolidin-3-amine (PubChem CID 114866692) has the molecular formula C11H14ClFN2 and a molecular weight of 228.70 g/mol. Its IUPAC name is 2-(5-chloro-2-fluorophenyl)-1-methylpyrrolidin-3-amine.
| Compound Name | 2-(5-chloro-2-fluorophenyl)-1-methylpyrrolidin-3-amine |
|---|---|
| PubChem CID | 114866692 |
| Molecular Formula | C11H14ClFN2 |
| Molecular Weight | 228.70 g/mol |
| Exact Mass | 228.08 |
| IUPAC Name | 2-(5-chloro-2-fluorophenyl)-1-methylpyrrolidin-3-amine |
| SMILES | CN1CCC(N)C1c1cc(Cl)ccc1F |
| InChI | InChI=1S/C11H14ClFN2/c1-15-5-4-10(14)11(15)8-6-7(12)2-3-9(8)13/h2-3,6,10-11H,4-5,14H2,1H3 |
| InChIKey | PBWJPMDWJNCLBZ-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.70 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |