C12H11ClFNO2 — CID 114867087
3-[(5-chloro-2-fluorophenyl)-hydroxymethyl]oxolane-3-carbonitrile (PubChem CID 114867087) has the molecular formula C12H11ClFNO2 and a molecular weight of 255.68 g/mol. Its IUPAC name is 3-[(5-chloro-2-fluorophenyl)-hydroxymethyl]oxolane-3-carbonitrile.
| Compound Name | 3-[(5-chloro-2-fluorophenyl)-hydroxymethyl]oxolane-3-carbonitrile |
|---|---|
| PubChem CID | 114867087 |
| Molecular Formula | C12H11ClFNO2 |
| Molecular Weight | 255.68 g/mol |
| Exact Mass | 255.05 |
| IUPAC Name | 3-[(5-chloro-2-fluorophenyl)-hydroxymethyl]oxolane-3-carbonitrile |
| SMILES | N#CC1(C(O)c2cc(Cl)ccc2F)CCOC1 |
| InChI | InChI=1S/C12H11ClFNO2/c13-8-1-2-10(14)9(5-8)11(16)12(6-15)3-4-17-7-12/h1-2,5,11,16H,3-4,7H2 |
| InChIKey | NDKMSUGQXIUVAT-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 53.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.68 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |