C13H13Cl2NO2 — CID 103715743
3-[(2,4-dichlorophenyl)-hydroxymethyl]oxane-3-carbonitrile (PubChem CID 103715743) has the molecular formula C13H13Cl2NO2 and a molecular weight of 286.16 g/mol. Its IUPAC name is 3-[(2,4-dichlorophenyl)-hydroxymethyl]oxane-3-carbonitrile.
| Compound Name | 3-[(2,4-dichlorophenyl)-hydroxymethyl]oxane-3-carbonitrile |
|---|---|
| PubChem CID | 103715743 |
| Molecular Formula | C13H13Cl2NO2 |
| Molecular Weight | 286.16 g/mol |
| Exact Mass | 285.03 |
| IUPAC Name | 3-[(2,4-dichlorophenyl)-hydroxymethyl]oxane-3-carbonitrile |
| SMILES | N#CC1(C(O)c2ccc(Cl)cc2Cl)CCCOC1 |
| InChI | InChI=1S/C13H13Cl2NO2/c14-9-2-3-10(11(15)6-9)12(17)13(7-16)4-1-5-18-8-13/h2-3,6,12,17H,1,4-5,8H2 |
| InChIKey | SYUWIHAXQKWZPC-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 53.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.16 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |