C14H16FNO3 — CID 103715861
3-[(3-fluoro-4-methoxyphenyl)-hydroxymethyl]oxane-3-carbonitrile (PubChem CID 103715861) has the molecular formula C14H16FNO3 and a molecular weight of 265.28 g/mol. Its IUPAC name is 3-[(3-fluoro-4-methoxyphenyl)-hydroxymethyl]oxane-3-carbonitrile.
| Compound Name | 3-[(3-fluoro-4-methoxyphenyl)-hydroxymethyl]oxane-3-carbonitrile |
|---|---|
| PubChem CID | 103715861 |
| Molecular Formula | C14H16FNO3 |
| Molecular Weight | 265.28 g/mol |
| Exact Mass | 265.11 |
| IUPAC Name | 3-[(3-fluoro-4-methoxyphenyl)-hydroxymethyl]oxane-3-carbonitrile |
| SMILES | COc1ccc(C(O)C2(C#N)CCCOC2)cc1F |
| InChI | InChI=1S/C14H16FNO3/c1-18-12-4-3-10(7-11(12)15)13(17)14(8-16)5-2-6-19-9-14/h3-4,7,13,17H,2,5-6,9H2,1H3 |
| InChIKey | UFVVNCRKZXPTPP-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 62.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.28 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |