C14H16BrNO3 — CID 79136999
4-[(3-bromo-4-methoxyphenyl)-hydroxymethyl]oxane-4-carbonitrile (PubChem CID 79136999) has the molecular formula C14H16BrNO3 and a molecular weight of 326.19 g/mol. Its IUPAC name is 4-[(3-bromo-4-methoxyphenyl)-hydroxymethyl]oxane-4-carbonitrile.
| Compound Name | 4-[(3-bromo-4-methoxyphenyl)-hydroxymethyl]oxane-4-carbonitrile |
|---|---|
| PubChem CID | 79136999 |
| Molecular Formula | C14H16BrNO3 |
| Molecular Weight | 326.19 g/mol |
| Exact Mass | 325.03 |
| IUPAC Name | 4-[(3-bromo-4-methoxyphenyl)-hydroxymethyl]oxane-4-carbonitrile |
| SMILES | COc1ccc(C(O)C2(C#N)CCOCC2)cc1Br |
| InChI | InChI=1S/C14H16BrNO3/c1-18-12-3-2-10(8-11(12)15)13(17)14(9-16)4-6-19-7-5-14/h2-3,8,13,17H,4-7H2,1H3 |
| InChIKey | SSPVSNXEOOGNJV-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 62.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.19 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |