C17H22N2O2 — CID 79124522
4-[hydroxy-(1-methyl-3,4-dihydro-2H-quinolin-6-yl)methyl]oxane-4-carbonitrile (PubChem CID 79124522) has the molecular formula C17H22N2O2 and a molecular weight of 286.37 g/mol. Its IUPAC name is 4-[hydroxy-(1-methyl-3,4-dihydro-2H-quinolin-6-yl)methyl]oxane-4-carbonitrile.
| Compound Name | 4-[hydroxy-(1-methyl-3,4-dihydro-2H-quinolin-6-yl)methyl]oxane-4-carbonitrile |
|---|---|
| PubChem CID | 79124522 |
| Molecular Formula | C17H22N2O2 |
| Molecular Weight | 286.37 g/mol |
| Exact Mass | 286.17 |
| IUPAC Name | 4-[hydroxy-(1-methyl-3,4-dihydro-2H-quinolin-6-yl)methyl]oxane-4-carbonitrile |
| SMILES | CN1CCCc2cc(C(O)C3(C#N)CCOCC3)ccc21 |
| InChI | InChI=1S/C17H22N2O2/c1-19-8-2-3-13-11-14(4-5-15(13)19)16(20)17(12-18)6-9-21-10-7-17/h4-5,11,16,20H,2-3,6-10H2,1H3 |
| InChIKey | MAMOPNCSPPTQND-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 56.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.37 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|