C11H13NO2S — CID 103715741
3-[hydroxy(thiophen-3-yl)methyl]oxane-3-carbonitrile (PubChem CID 103715741) has the molecular formula C11H13NO2S and a molecular weight of 223.30 g/mol. Its IUPAC name is 3-[hydroxy(thiophen-3-yl)methyl]oxane-3-carbonitrile.
| Compound Name | 3-[hydroxy(thiophen-3-yl)methyl]oxane-3-carbonitrile |
|---|---|
| PubChem CID | 103715741 |
| Molecular Formula | C11H13NO2S |
| Molecular Weight | 223.30 g/mol |
| Exact Mass | 223.07 |
| IUPAC Name | 3-[hydroxy(thiophen-3-yl)methyl]oxane-3-carbonitrile |
| SMILES | N#CC1(C(O)c2ccsc2)CCCOC1 |
| InChI | InChI=1S/C11H13NO2S/c12-7-11(3-1-4-14-8-11)10(13)9-2-5-15-6-9/h2,5-6,10,13H,1,3-4,8H2 |
| InChIKey | YSPOFMMUUYDZRY-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 53.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.30 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |